C13H15NO4S — CID 55066889
(E)-3-[3-(cyclobutylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 55066889) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (E)-3-[3-(cyclobutylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(cyclobutylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55066889 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (E)-3-[3-(cyclobutylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(S(=O)(=O)NC2CCC2)c1 |
| InChI | InChI=1S/C13H15NO4S/c15-13(16)8-7-10-3-1-6-12(9-10)19(17,18)14-11-4-2-5-11/h1,3,6-9,11,14H,2,4-5H2,(H,15,16)/b8-7+ |
| InChIKey | SEFOHXPXDSRYKC-BQYQJAHWSA-N |
| XLogP | 1.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|