C11H12N2O4S — CID 76922979
3-[5-(cyclopropylsulfamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 76922979) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-[5-(cyclopropylsulfamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[5-(cyclopropylsulfamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76922979 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-[5-(cyclopropylsulfamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cncc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C11H12N2O4S/c14-11(15)4-1-8-5-10(7-12-6-8)18(16,17)13-9-2-3-9/h1,4-7,9,13H,2-3H2,(H,14,15) |
| InChIKey | IBMOEKYVKZMTLQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|