C13H16N2O4S — CID 76922893
3-[5-(1-cyclopropylethylsulfamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 76922893) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-[5-(1-cyclopropylethylsulfamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[5-(1-cyclopropylethylsulfamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76922893 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-[5-(1-cyclopropylethylsulfamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC(NS(=O)(=O)c1cncc(C=CC(=O)O)c1)C1CC1 |
| InChI | InChI=1S/C13H16N2O4S/c1-9(11-3-4-11)15-20(18,19)12-6-10(7-14-8-12)2-5-13(16)17/h2,5-9,11,15H,3-4H2,1H3,(H,16,17) |
| InChIKey | KKHWXVHPVIMPOT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|