C12H14N2O4S2 — CID 76922913
3-(5-thiomorpholin-4-ylsulfonyl-3-pyridinyl)prop-2-enoic acid (PubChem CID 76922913) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-(5-thiomorpholin-4-ylsulfonyl-3-pyridinyl)prop-2-enoic acid.
| Compound Name | 3-(5-thiomorpholin-4-ylsulfonyl-3-pyridinyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 76922913 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-(5-thiomorpholin-4-ylsulfonyl-3-pyridinyl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cncc(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C12H14N2O4S2/c15-12(16)2-1-10-7-11(9-13-8-10)20(17,18)14-3-5-19-6-4-14/h1-2,7-9H,3-6H2,(H,15,16) |
| InChIKey | CRILULLRDCCCFK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|