C13H15NO4S2 — CID 76907292
3-(3-thiomorpholin-4-ylsulfonylphenyl)prop-2-enoic acid (PubChem CID 76907292) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(3-thiomorpholin-4-ylsulfonylphenyl)prop-2-enoic acid.
| Compound Name | 3-(3-thiomorpholin-4-ylsulfonylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 76907292 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3-(3-thiomorpholin-4-ylsulfonylphenyl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C13H15NO4S2/c15-13(16)5-4-11-2-1-3-12(10-11)20(17,18)14-6-8-19-9-7-14/h1-5,10H,6-9H2,(H,15,16) |
| InChIKey | APPSQNJRQNGMNX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|