C16H21NO4S — CID 77199749
ethyl 3-(3-piperidin-1-ylsulfonylphenyl)prop-2-enoate (PubChem CID 77199749) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is ethyl 3-(3-piperidin-1-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | ethyl 3-(3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 77199749 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethyl 3-(3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C16H21NO4S/c1-2-21-16(18)10-9-14-7-6-8-15(13-14)22(19,20)17-11-4-3-5-12-17/h6-10,13H,2-5,11-12H2,1H3 |
| InChIKey | WKAPLHSSNRGSOM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|