C22H23ClN2O5S — CID 27902482
ethyl (E)-3-[4-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]phenyl]prop-2-enoate (PubChem CID 27902482) has the molecular formula C22H23ClN2O5S and a molecular weight of 462.96 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 27902482 |
| Molecular Formula | C22H23ClN2O5S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | ethyl (E)-3-[4-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O5S/c1-2-30-21(26)12-7-16-5-8-17(9-6-16)24-22(27)19-15-18(10-11-20(19)23)31(28,29)25-13-3-4-14-25/h5-12,15H,2-4,13-14H2,1H3,(H,24,27)/b12-7+ |
| InChIKey | QZJWLRKYHXEGCM-KPKJPENVSA-N |
| XLogP | 3.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|