C19H22ClN3O6S2 — CID 55389383
2-chloro-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55389383) has the molecular formula C19H22ClN3O6S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 2-chloro-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55389383 |
| Molecular Formula | C19H22ClN3O6S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 2-chloro-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O6S2/c1-22(29-2)30(25,26)15-7-5-14(6-8-15)21-19(24)17-13-16(9-10-18(17)20)31(27,28)23-11-3-4-12-23/h5-10,13H,3-4,11-12H2,1-2H3,(H,21,24) |
| InChIKey | APMSSVQNLCCYPS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|