C13H15NO6S — CID 106673603
(E)-3-[3-(3,4-dihydroxypyrrolidin-1-yl)sulfonylphenyl]prop-2-enoic acid (PubChem CID 106673603) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is (E)-3-[3-(3,4-dihydroxypyrrolidin-1-yl)sulfonylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(3,4-dihydroxypyrrolidin-1-yl)sulfonylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106673603 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (E)-3-[3-(3,4-dihydroxypyrrolidin-1-yl)sulfonylphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(S(=O)(=O)N2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C13H15NO6S/c15-11-7-14(8-12(11)16)21(19,20)10-3-1-2-9(6-10)4-5-13(17)18/h1-6,11-12,15-16H,7-8H2,(H,17,18)/b5-4+ |
| InChIKey | PJGALZHPAGLANY-SNAWJCMRSA-N |
| XLogP | -0.49 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|