C21H20Cl2N2O3S — CID 91169398
3-[3-[4-[4-(1-chloroethenyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride (PubChem CID 91169398) has the molecular formula C21H20Cl2N2O3S and a molecular weight of 451.38 g/mol. Its IUPAC name is 3-[3-[4-[4-(1-chloroethenyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride.
| Compound Name | 3-[3-[4-[4-(1-chloroethenyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride |
|---|---|
| PubChem CID | 91169398 |
| Molecular Formula | C21H20Cl2N2O3S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 3-[3-[4-[4-(1-chloroethenyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride |
| SMILES | C=C(Cl)c1ccc(N2CCN(S(=O)(=O)c3cccc(C=CC(=O)Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O3S/c1-16(22)18-6-8-19(9-7-18)24-11-13-25(14-12-24)29(27,28)20-4-2-3-17(15-20)5-10-21(23)26/h2-10,15H,1,11-14H2 |
| InChIKey | IIROFDXBCLQFFG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|