C20H22N2O5S — CID 67010298
(E)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid (PubChem CID 67010298) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is (E)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67010298 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (E)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)c2cccc(/C=C/C(=O)O)c2)CC1 |
| InChI | InChI=1S/C20H22N2O5S/c1-27-19-8-3-2-7-18(19)21-11-13-22(14-12-21)28(25,26)17-6-4-5-16(15-17)9-10-20(23)24/h2-10,15H,11-14H2,1H3,(H,23,24)/b10-9+ |
| InChIKey | TVJMEJSGULEDSX-MDZDMXLPSA-N |
| XLogP | 2.30 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|