C21H24N2O5S — CID 58509577
(E)-1-hydroxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]but-3-en-2-one (PubChem CID 58509577) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is (E)-1-hydroxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]but-3-en-2-one.
| Compound Name | (E)-1-hydroxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 58509577 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (E)-1-hydroxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]but-3-en-2-one |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)c2ccc(/C=C/C(=O)CO)cc2)CC1 |
| InChI | InChI=1S/C21H24N2O5S/c1-28-21-5-3-2-4-20(21)22-12-14-23(15-13-22)29(26,27)19-10-7-17(8-11-19)6-9-18(25)16-24/h2-11,24H,12-16H2,1H3/b9-6+ |
| InChIKey | CCRGUQPEWDRDIK-RMKNXTFCSA-N |
| XLogP | 1.78 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|