C19H22N2O6S — CID 2324705
2-methoxy-5-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylbenzoic acid (PubChem CID 2324705) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-methoxy-5-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-methoxy-5-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 2324705 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-methoxy-5-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylbenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccccc3OC)CC2)cc1C(=O)O |
| InChI | InChI=1S/C19H22N2O6S/c1-26-17-8-7-14(13-15(17)19(22)23)28(24,25)21-11-9-20(10-12-21)16-5-3-4-6-18(16)27-2/h3-8,13H,9-12H2,1-2H3,(H,22,23) |
| InChIKey | CLVAJKORECMLFW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |