C30H28N2O5S — CID 10482055
1-[(2,2-diphenyl-1,3-benzodioxol-5-yl)sulfonyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 10482055) has the molecular formula C30H28N2O5S and a molecular weight of 528.63 g/mol. Its IUPAC name is 1-[(2,2-diphenyl-1,3-benzodioxol-5-yl)sulfonyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[(2,2-diphenyl-1,3-benzodioxol-5-yl)sulfonyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 10482055 |
| Molecular Formula | C30H28N2O5S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-[(2,2-diphenyl-1,3-benzodioxol-5-yl)sulfonyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)c2ccc3c(c2)OC(c2ccccc2)(c2ccccc2)O3)CC1 |
| InChI | InChI=1S/C30H28N2O5S/c1-35-27-15-9-8-14-26(27)31-18-20-32(21-19-31)38(33,34)25-16-17-28-29(22-25)37-30(36-28,23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-17,22H,18-21H2,1H3 |
| InChIKey | AUYDKZDOPZTEPH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |