C25H33N3O3S — CID 149281042
1-[[1-(4-ethenylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 149281042) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 1-[[1-(4-ethenylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[[1-(4-ethenylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 149281042 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-[[1-(4-ethenylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | C=Cc1ccc(S(=O)(=O)N2CCC(CN3CCN(c4ccccc4OC)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O3S/c1-3-21-8-10-23(11-9-21)32(29,30)28-14-12-22(13-15-28)20-26-16-18-27(19-17-26)24-6-4-5-7-25(24)31-2/h3-11,22H,1,12-20H2,2H3 |
| InChIKey | XSYNJNJWXQHGJI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |