C10H11N3O5S — CID 76923030
3-[5-[(2-amino-2-oxoethyl)sulfamoyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 76923030) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 3-[5-[(2-amino-2-oxoethyl)sulfamoyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[5-[(2-amino-2-oxoethyl)sulfamoyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76923030 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-[5-[(2-amino-2-oxoethyl)sulfamoyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | NC(=O)CNS(=O)(=O)c1cncc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C10H11N3O5S/c11-9(14)6-13-19(17,18)8-3-7(4-12-5-8)1-2-10(15)16/h1-5,13H,6H2,(H2,11,14)(H,15,16) |
| InChIKey | ZZTJDEQQRVDFKJ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|