C11H10Cl2N2O5S — CID 76906866
3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3,5-dichlorophenyl]prop-2-enoic acid (PubChem CID 76906866) has the molecular formula C11H10Cl2N2O5S and a molecular weight of 353.18 g/mol. Its IUPAC name is 3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3,5-dichlorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3,5-dichlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906866 |
| Molecular Formula | C11H10Cl2N2O5S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3,5-dichlorophenyl]prop-2-enoic acid |
| SMILES | NC(=O)CNS(=O)(=O)c1c(Cl)cc(C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O5S/c12-7-3-6(1-2-10(17)18)4-8(13)11(7)21(19,20)15-5-9(14)16/h1-4,15H,5H2,(H2,14,16)(H,17,18) |
| InChIKey | VHLXSYJUMUHJSV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|