C9H10Cl2N2O4S — CID 43257166
methyl 2-[(4-amino-2,6-dichlorophenyl)sulfonylamino]acetate (PubChem CID 43257166) has the molecular formula C9H10Cl2N2O4S and a molecular weight of 313.16 g/mol. Its IUPAC name is methyl 2-[(4-amino-2,6-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | methyl 2-[(4-amino-2,6-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 43257166 |
| Molecular Formula | C9H10Cl2N2O4S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | methyl 2-[(4-amino-2,6-dichlorophenyl)sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O4S/c1-17-8(14)4-13-18(15,16)9-6(10)2-5(12)3-7(9)11/h2-3,13H,4,12H2,1H3 |
| InChIKey | AHOUMXSQSSTGHP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|