C9H8Cl3NO4S — CID 43624222
methyl 2-[(2,4,6-trichlorophenyl)sulfonylamino]acetate (PubChem CID 43624222) has the molecular formula C9H8Cl3NO4S and a molecular weight of 332.59 g/mol. Its IUPAC name is methyl 2-[(2,4,6-trichlorophenyl)sulfonylamino]acetate.
| Compound Name | methyl 2-[(2,4,6-trichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 43624222 |
| Molecular Formula | C9H8Cl3NO4S |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | methyl 2-[(2,4,6-trichlorophenyl)sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl3NO4S/c1-17-8(14)4-13-18(15,16)9-6(11)2-5(10)3-7(9)12/h2-3,13H,4H2,1H3 |
| InChIKey | ZYJBXYJAKMFFTJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |