C9H8Cl3NO2S — CID 61060580
2,4,6-trichloro-N-prop-2-enylbenzenesulfonamide (PubChem CID 61060580) has the molecular formula C9H8Cl3NO2S and a molecular weight of 300.59 g/mol. Its IUPAC name is 2,4,6-trichloro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 61060580 |
| Molecular Formula | C9H8Cl3NO2S |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 2,4,6-trichloro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl3NO2S/c1-2-3-13-16(14,15)9-7(11)4-6(10)5-8(9)12/h2,4-5,13H,1,3H2 |
| InChIKey | OCOVKAMGGSUDKX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|