C13H19Cl3N2O2S — CID 55871539
2,4,6-trichloro-N-[2-(diethylamino)propyl]benzenesulfonamide (PubChem CID 55871539) has the molecular formula C13H19Cl3N2O2S and a molecular weight of 373.73 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[2-(diethylamino)propyl]benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-[2-(diethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55871539 |
| Molecular Formula | C13H19Cl3N2O2S |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2,4,6-trichloro-N-[2-(diethylamino)propyl]benzenesulfonamide |
| SMILES | CCN(CC)C(C)CNS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl3N2O2S/c1-4-18(5-2)9(3)8-17-21(19,20)13-11(15)6-10(14)7-12(13)16/h6-7,9,17H,4-5,8H2,1-3H3 |
| InChIKey | LDOKKZCMACUSRU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |