C14H24N2O4S2 — CID 42960034
N-[2-(diethylamino)propyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 42960034) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(diethylamino)propyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 42960034 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[2-(diethylamino)propyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(CC)C(C)CNS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H24N2O4S2/c1-5-16(6-2)12(3)11-15-22(19,20)14-9-7-13(8-10-14)21(4,17)18/h7-10,12,15H,5-6,11H2,1-4H3 |
| InChIKey | OWDRHAWINOIPKS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |