C15H26N2O4S2 — CID 60532350
N-[2-(diethylamino)propyl]-2-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 60532350) has the molecular formula C15H26N2O4S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-2-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(diethylamino)propyl]-2-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 60532350 |
| Molecular Formula | C15H26N2O4S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[2-(diethylamino)propyl]-2-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(CC)C(C)CNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1C |
| InChI | InChI=1S/C15H26N2O4S2/c1-6-17(7-2)13(4)11-16-23(20,21)15-10-14(22(5,18)19)9-8-12(15)3/h8-10,13,16H,6-7,11H2,1-5H3 |
| InChIKey | HGMVXFIJPUXGPX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |