C18H31N3O3S — CID 95341841
4-[[(2S)-2-(diethylamino)propyl]sulfamoyl]-N,N-diethylbenzamide (PubChem CID 95341841) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is 4-[[(2S)-2-(diethylamino)propyl]sulfamoyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[(2S)-2-(diethylamino)propyl]sulfamoyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 95341841 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-[[(2S)-2-(diethylamino)propyl]sulfamoyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(S(=O)(=O)NC[C@H](C)N(CC)CC)cc1 |
| InChI | InChI=1S/C18H31N3O3S/c1-6-20(7-2)15(5)14-19-25(23,24)17-12-10-16(11-13-17)18(22)21(8-3)9-4/h10-13,15,19H,6-9,14H2,1-5H3/t15-/m0/s1 |
| InChIKey | VSJWWONGYOGGSE-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |