C12H18N2O4S — CID 47051185
N,N-diethyl-4-(methoxysulfamoyl)benzamide (PubChem CID 47051185) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N,N-diethyl-4-(methoxysulfamoyl)benzamide.
| Compound Name | N,N-diethyl-4-(methoxysulfamoyl)benzamide |
|---|---|
| PubChem CID | 47051185 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N,N-diethyl-4-(methoxysulfamoyl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(S(=O)(=O)NOC)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-4-14(5-2)12(15)10-6-8-11(9-7-10)19(16,17)13-18-3/h6-9,13H,4-5H2,1-3H3 |
| InChIKey | SJPTUUDFRRVKRA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|