C22H27N3O6S — CID 29459101
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate (PubChem CID 29459101) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 29459101 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ccc(C(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O6S/c1-4-23-32(29,30)19-13-9-17(10-14-19)22(28)31-15-20(26)24-18-11-7-16(8-12-18)21(27)25(5-2)6-3/h7-14,23H,4-6,15H2,1-3H3,(H,24,26) |
| InChIKey | PJQPKUKHFCVBPQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |