C18H19N3O6S — CID 8954643
[2-oxo-2-(phenylcarbamoylamino)ethyl] 4-(ethylsulfamoyl)benzoate (PubChem CID 8954643) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is [2-oxo-2-(phenylcarbamoylamino)ethyl] 4-(ethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8954643 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O6S/c1-2-19-28(25,26)15-10-8-13(9-11-15)17(23)27-12-16(22)21-18(24)20-14-6-4-3-5-7-14/h3-11,19H,2,12H2,1H3,(H2,20,21,22,24) |
| InChIKey | AZHFYNCDRRHIKX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |