C18H18N2O6S — CID 55404127
[2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-(methylsulfamoyl)benzoate (PubChem CID 55404127) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55404127 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)OCC(=O)NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-19-27(24,25)15-9-7-14(8-10-15)18(23)26-12-17(22)20-16(21)11-13-5-3-2-4-6-13/h2-10,19H,11-12H2,1H3,(H,20,21,22) |
| InChIKey | BHGKXOQABKHXKE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |