C18H20N2O5S2 — CID 7429620
[2-(3-methylsulfanylanilino)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate (PubChem CID 7429620) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7429620 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cccc(SC)c2)cc1 |
| InChI | InChI=1S/C18H20N2O5S2/c1-3-19-27(23,24)16-9-7-13(8-10-16)18(22)25-12-17(21)20-14-5-4-6-15(11-14)26-2/h4-11,19H,3,12H2,1-2H3,(H,20,21) |
| InChIKey | RLJOMPHDZDHUHE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |