C19H20N2O6S — CID 7752504
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 7752504) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7752504 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O6S/c1-21(2)18(23)13-4-8-15(9-5-13)20-17(22)12-27-19(24)14-6-10-16(11-7-14)28(3,25)26/h4-11H,12H2,1-3H3,(H,20,22) |
| InChIKey | UWXFCBPRUAQOJP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |