C18H20N2O7S2 — CID 16514566
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 16514566) has the molecular formula C18H20N2O7S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 16514566 |
| Molecular Formula | C18H20N2O7S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O7S2/c1-20(2)29(25,26)16-10-6-14(7-11-16)19-17(21)12-27-18(22)13-4-8-15(9-5-13)28(3,23)24/h4-11H,12H2,1-3H3,(H,19,21) |
| InChIKey | SWLPPTQRKFQACA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |