C17H16Cl2N2O5S — CID 2603676
[2-(2,6-dichloroanilino)-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate (PubChem CID 2603676) has the molecular formula C17H16Cl2N2O5S and a molecular weight of 431.30 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2603676 |
| Molecular Formula | C17H16Cl2N2O5S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O5S/c1-21(2)27(24,25)12-8-6-11(7-9-12)17(23)26-10-15(22)20-16-13(18)4-3-5-14(16)19/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | SAKXVFICSWWDEH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |