C22H26N2O4 — CID 8538268
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-(2-methylpropyl)benzoate (PubChem CID 8538268) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-(2-methylpropyl)benzoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-(2-methylpropyl)benzoate |
|---|---|
| PubChem CID | 8538268 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 4-(2-methylpropyl)benzoate |
| SMILES | CC(C)Cc1ccc(C(=O)OCC(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-15(2)13-16-5-7-18(8-6-16)22(27)28-14-20(25)23-19-11-9-17(10-12-19)21(26)24(3)4/h5-12,15H,13-14H2,1-4H3,(H,23,25) |
| InChIKey | MFHCITIXURKJOO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |