C20H22N2O6S — CID 7744614
[2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 7744614) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is [2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7744614 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O6S/c1-14-4-8-16(9-5-14)21-18(23)12-22(2)19(24)13-28-20(25)15-6-10-17(11-7-15)29(3,26)27/h4-11H,12-13H2,1-3H3,(H,21,23) |
| InChIKey | RWEAHKGSCVXKLA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |