C20H25N3O5S — CID 56512067
4-[[ethyl-[4-(methoxysulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 56512067) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[[ethyl-[4-(methoxysulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[ethyl-[4-(methoxysulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 56512067 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[[ethyl-[4-(methoxysulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN(Cc1ccc(C(=O)N(C)C)cc1)C(=O)c1ccc(S(=O)(=O)NOC)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-5-23(14-15-6-8-16(9-7-15)19(24)22(2)3)20(25)17-10-12-18(13-11-17)29(26,27)21-28-4/h6-13,21H,5,14H2,1-4H3 |
| InChIKey | AHDDDJKKSXBNNF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|