C18H21ClN2O3S — CID 98388271
4-[[(4-chlorophenyl)sulfonyl-ethylamino]methyl]-N,N-dimethylbenzamide (PubChem CID 98388271) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonyl-ethylamino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonyl-ethylamino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 98388271 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonyl-ethylamino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN(Cc1ccc(C(=O)N(C)C)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-4-21(25(23,24)17-11-9-16(19)10-12-17)13-14-5-7-15(8-6-14)18(22)20(2)3/h5-12H,4,13H2,1-3H3 |
| InChIKey | PAGLLWCOCWZKRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |