C16H16ClNO4S — CID 26057385
methyl 4-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]benzoate (PubChem CID 26057385) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is methyl 4-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 26057385 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | methyl 4-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-18(23(20,21)15-9-7-14(17)8-10-15)11-12-3-5-13(6-4-12)16(19)22-2/h3-10H,11H2,1-2H3 |
| InChIKey | QGPWQSLZSMKRTM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |