C23H22ClNO5S — CID 123743688
methyl 4-[[benzenesulfonyl-[(1S)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]benzoate (PubChem CID 123743688) has the molecular formula C23H22ClNO5S and a molecular weight of 459.95 g/mol. Its IUPAC name is methyl 4-[[benzenesulfonyl-[(1S)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[benzenesulfonyl-[(1S)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 123743688 |
| Molecular Formula | C23H22ClNO5S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | methyl 4-[[benzenesulfonyl-[(1S)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN([C@H](CO)c2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22ClNO5S/c1-30-23(27)19-9-7-17(8-10-19)15-25(31(28,29)21-5-3-2-4-6-21)22(16-26)18-11-13-20(24)14-12-18/h2-14,22,26H,15-16H2,1H3/t22-/m1/s1 |
| InChIKey | NBZDNYCBMZHDPH-JOCHJYFZSA-N |
| XLogP | 4.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |