C23H28ClNO4S — CID 78107937
methyl 4-[[(4-chlorophenyl)sulfonyl-(1-cyclopentylpropyl)amino]methyl]benzoate (PubChem CID 78107937) has the molecular formula C23H28ClNO4S and a molecular weight of 450.00 g/mol. Its IUPAC name is methyl 4-[[(4-chlorophenyl)sulfonyl-(1-cyclopentylpropyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(4-chlorophenyl)sulfonyl-(1-cyclopentylpropyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 78107937 |
| Molecular Formula | C23H28ClNO4S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | methyl 4-[[(4-chlorophenyl)sulfonyl-(1-cyclopentylpropyl)amino]methyl]benzoate |
| SMILES | CCC(C1CCCC1)N(Cc1ccc(C(=O)OC)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClNO4S/c1-3-22(18-6-4-5-7-18)25(30(27,28)21-14-12-20(24)13-15-21)16-17-8-10-19(11-9-17)23(26)29-2/h8-15,18,22H,3-7,16H2,1-2H3 |
| InChIKey | GSCLZQVWTYIKCB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |