C22H25ClFNO4S — CID 90364669
methyl 4-[[(4-chlorophenyl)sulfonyl-[3-(fluoromethyl)cyclohexyl]amino]methyl]benzoate (PubChem CID 90364669) has the molecular formula C22H25ClFNO4S and a molecular weight of 453.96 g/mol. Its IUPAC name is methyl 4-[[(4-chlorophenyl)sulfonyl-[3-(fluoromethyl)cyclohexyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(4-chlorophenyl)sulfonyl-[3-(fluoromethyl)cyclohexyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 90364669 |
| Molecular Formula | C22H25ClFNO4S |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | methyl 4-[[(4-chlorophenyl)sulfonyl-[3-(fluoromethyl)cyclohexyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C2CCCC(CF)C2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H25ClFNO4S/c1-29-22(26)18-7-5-16(6-8-18)15-25(20-4-2-3-17(13-20)14-24)30(27,28)21-11-9-19(23)10-12-21/h5-12,17,20H,2-4,13-15H2,1H3 |
| InChIKey | AOYILLQGTIBTCM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |