C20H21F2NO6S — CID 26540361
methyl 4-[cyclopropyl-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]sulfamoyl]benzoate (PubChem CID 26540361) has the molecular formula C20H21F2NO6S and a molecular weight of 441.45 g/mol. Its IUPAC name is methyl 4-[cyclopropyl-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[cyclopropyl-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 26540361 |
| Molecular Formula | C20H21F2NO6S |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | methyl 4-[cyclopropyl-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(Cc2ccc(OC(F)F)c(OC)c2)C2CC2)cc1 |
| InChI | InChI=1S/C20H21F2NO6S/c1-27-18-11-13(3-10-17(18)29-20(21)22)12-23(15-6-7-15)30(25,26)16-8-4-14(5-9-16)19(24)28-2/h3-5,8-11,15,20H,6-7,12H2,1-2H3 |
| InChIKey | LZIHLLHAXNLABN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |