C16H16BrF2NO4S — CID 30329611
4-bromo-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylbenzenesulfonamide (PubChem CID 30329611) has the molecular formula C16H16BrF2NO4S and a molecular weight of 436.27 g/mol. Its IUPAC name is 4-bromo-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 30329611 |
| Molecular Formula | C16H16BrF2NO4S |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 4-bromo-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methylbenzenesulfonamide |
| SMILES | COc1cc(CN(C)S(=O)(=O)c2ccc(Br)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C16H16BrF2NO4S/c1-20(25(21,22)13-6-4-12(17)5-7-13)10-11-3-8-14(24-16(18)19)15(9-11)23-2/h3-9,16H,10H2,1-2H3 |
| InChIKey | FTWXADHGGXXHDT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |