C22H23NO5S — CID 38019730
N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-4-phenoxybenzenesulfonamide (PubChem CID 38019730) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-4-phenoxybenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 38019730 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-4-phenoxybenzenesulfonamide |
| SMILES | COc1ccc(CN(C)S(=O)(=O)c2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C22H23NO5S/c1-23(16-17-9-14-21(26-2)22(15-17)27-3)29(24,25)20-12-10-19(11-13-20)28-18-7-5-4-6-8-18/h4-15H,16H2,1-3H3 |
| InChIKey | YBGRHDJNVFKIND-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |