C11H16ClNO4S — CID 55246405
1-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylmethanesulfonamide (PubChem CID 55246405) has the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. Its IUPAC name is 1-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylmethanesulfonamide.
| Compound Name | 1-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 55246405 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylmethanesulfonamide |
| SMILES | COc1ccc(CN(C)S(=O)(=O)CCl)cc1OC |
| InChI | InChI=1S/C11H16ClNO4S/c1-13(18(14,15)8-12)7-9-4-5-10(16-2)11(6-9)17-3/h4-6H,7-8H2,1-3H3 |
| InChIKey | VEVROVIPAJOHKN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|