C10H14ClNO4S — CID 21044514
[5-(chloromethyl)-2-methoxyphenyl] N,N-dimethylsulfamate (PubChem CID 21044514) has the molecular formula C10H14ClNO4S and a molecular weight of 279.75 g/mol. Its IUPAC name is [5-(chloromethyl)-2-methoxyphenyl] N,N-dimethylsulfamate.
| Compound Name | [5-(chloromethyl)-2-methoxyphenyl] N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 21044514 |
| Molecular Formula | C10H14ClNO4S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | [5-(chloromethyl)-2-methoxyphenyl] N,N-dimethylsulfamate |
| SMILES | COc1ccc(CCl)cc1OS(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H14ClNO4S/c1-12(2)17(13,14)16-10-6-8(7-11)4-5-9(10)15-3/h4-6H,7H2,1-3H3 |
| InChIKey | MUFBCZUJMVXZDQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|