C9H11Cl2NO3S — CID 21044470
[2-chloro-4-(chloromethyl)phenyl] N,N-dimethylsulfamate (PubChem CID 21044470) has the molecular formula C9H11Cl2NO3S and a molecular weight of 284.16 g/mol. Its IUPAC name is [2-chloro-4-(chloromethyl)phenyl] N,N-dimethylsulfamate.
| Compound Name | [2-chloro-4-(chloromethyl)phenyl] N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 21044470 |
| Molecular Formula | C9H11Cl2NO3S |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | [2-chloro-4-(chloromethyl)phenyl] N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1ccc(CCl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO3S/c1-12(2)16(13,14)15-9-4-3-7(6-10)5-8(9)11/h3-5H,6H2,1-2H3 |
| InChIKey | NEQBBISFTTUQBK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|