C8H11ClN2O3S — CID 23329889
(2-amino-4-chlorophenyl) N,N-dimethylsulfamate (PubChem CID 23329889) has the molecular formula C8H11ClN2O3S and a molecular weight of 250.71 g/mol. Its IUPAC name is (2-amino-4-chlorophenyl) N,N-dimethylsulfamate.
| Compound Name | (2-amino-4-chlorophenyl) N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 23329889 |
| Molecular Formula | C8H11ClN2O3S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (2-amino-4-chlorophenyl) N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1ccc(Cl)cc1N |
| InChI | InChI=1S/C8H11ClN2O3S/c1-11(2)15(12,13)14-8-4-3-6(9)5-7(8)10/h3-5H,10H2,1-2H3 |
| InChIKey | KIJNMPTWEBFGJT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|