C13H11Cl2NO3S — CID 43448156
2-(2,4-dichlorophenoxy)-5-methylsulfonylaniline (PubChem CID 43448156) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-5-methylsulfonylaniline.
| Compound Name | 2-(2,4-dichlorophenoxy)-5-methylsulfonylaniline |
|---|---|
| PubChem CID | 43448156 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-5-methylsulfonylaniline |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(Cl)cc2Cl)c(N)c1 |
| InChI | InChI=1S/C13H11Cl2NO3S/c1-20(17,18)9-3-5-13(11(16)7-9)19-12-4-2-8(14)6-10(12)15/h2-7H,16H2,1H3 |
| InChIKey | MKBVAOOSPOUYND-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|