C14H12BrClO5S2 — CID 60519600
1-(2-bromo-4-chlorophenoxy)-2,4-bis(methylsulfonyl)benzene (PubChem CID 60519600) has the molecular formula C14H12BrClO5S2 and a molecular weight of 439.74 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenoxy)-2,4-bis(methylsulfonyl)benzene.
| Compound Name | 1-(2-bromo-4-chlorophenoxy)-2,4-bis(methylsulfonyl)benzene |
|---|---|
| PubChem CID | 60519600 |
| Molecular Formula | C14H12BrClO5S2 |
| Molecular Weight | 439.74 g/mol |
| Exact Mass | 437.90 |
| IUPAC Name | 1-(2-bromo-4-chlorophenoxy)-2,4-bis(methylsulfonyl)benzene |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(Cl)cc2Br)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H12BrClO5S2/c1-22(17,18)10-4-6-13(14(8-10)23(2,19)20)21-12-5-3-9(16)7-11(12)15/h3-8H,1-2H3 |
| InChIKey | BPGOQTNKCDRMSX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.74 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |