C14H12BrFO5S2 — CID 133435000
4-[2,4-bis(methylsulfonyl)phenoxy]-2-bromo-1-fluorobenzene (PubChem CID 133435000) has the molecular formula C14H12BrFO5S2 and a molecular weight of 423.28 g/mol. Its IUPAC name is 4-[2,4-bis(methylsulfonyl)phenoxy]-2-bromo-1-fluorobenzene.
| Compound Name | 4-[2,4-bis(methylsulfonyl)phenoxy]-2-bromo-1-fluorobenzene |
|---|---|
| PubChem CID | 133435000 |
| Molecular Formula | C14H12BrFO5S2 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | 4-[2,4-bis(methylsulfonyl)phenoxy]-2-bromo-1-fluorobenzene |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(F)c(Br)c2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H12BrFO5S2/c1-22(17,18)10-4-6-13(14(8-10)23(2,19)20)21-9-3-5-12(16)11(15)7-9/h3-8H,1-2H3 |
| InChIKey | NJQFVWVOYPLIGB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |